CAS 131505-02-7

N-(2-bromoethyl)-3-(2-nitro-1H-imidazol-1-yl)propan-1-amine hydrobromide (1:1)

Description:

N-(2-bromoethyl)-3-(2-nitro-1H-imidazol-1-yl)propan-1-amine hydrobromide is a chemical compound characterized by its complex structure, which includes a bromoethyl group, a nitro-substituted imidazole ring, and a propan-1-amine backbone. This compound is typically encountered as a hydrobromide salt, which enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the nitro group suggests potential biological activity, as nitroimidazoles are often associated with antimicrobial and antitumor properties. The bromoethyl moiety can facilitate nucleophilic substitution reactions, which may be exploited in synthetic pathways. Additionally, the compound's hydrobromide form indicates that it can exist as a stable crystalline solid under appropriate conditions. Overall, this compound's unique functional groups and structural features make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₈H₁₄Br₂N₄O₂

InChI: InChI=1/C8H13BrN4O2.BrH/c9-2-4-10-3-1-6-12-7-5-11-8(12)13(14)15;/h5,7,10H,1-4,6H2;1H

Synonyms:

• 1H-Imidazole-1-propanamine, N-(2-bromoethyl)-2-nitro-, monohydrobromide

PD 130908

CAS: 131505-02-7

PD 130908, a less potent RSU 1069 analog, is a hypoxic cytotoxin with reduced systemic toxicity and significant radiosensitization potential.

Formula: C₈H₁₄Br₂N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 358.03

Ref: TM-T28327