CymitQuimica logo

CAS 131606-42-3

:

3-(3-AMINOPROPYL)SOLKETAL

Description:
3-(3-Aminopropyl)solketal, identified by its CAS number 131606-42-3, is a chemical compound characterized by its structure, which includes a solketal moiety and an aminoalkyl group. Solketal is derived from glycerol and acetone, and it is known for its stability and ability to act as a solvent or protective group in organic synthesis. The presence of the 3-aminopropyl group introduces amino functionality, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically colorless to pale yellow and may exhibit moderate solubility in polar solvents due to the presence of both hydrophobic and hydrophilic regions in its structure. Its applications may extend to pharmaceuticals, where it can serve as an intermediate or a building block in the synthesis of more complex molecules. Additionally, the amino group can enhance the compound's reactivity and potential for forming hydrogen bonds, making it useful in various chemical contexts. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H19NO3
InChI:InChI=1S/C9H19NO3/c1-9(2)12-7-8(13-9)6-11-5-3-4-10/h8H,3-7,10H2,1-2H3
InChI key:ALTVLQHLIFBSJJ-UHFFFAOYSA-N
SMILES:CC1(OCC(O1)COCCCN)C
Found 4 products.