CymitQuimica logo

CAS 131833-89-1

:

(S,S)-4,4'-diisopropyl-4,5,4',5'-tetrahydro[2.2]bioxazolyl

Description:
(S,S)-4,4'-diisopropyl-4,5,4',5'-tetrahydro[2.2]bioxazolyl is a chiral organic compound characterized by its unique bicyclic structure, which incorporates a bioxazole moiety. This compound features two isopropyl groups attached to the tetrahydro structure, contributing to its steric bulk and influencing its chemical reactivity and interactions. The presence of the bioxazole ring system imparts specific electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The stereochemistry indicated by the (S,S) configuration suggests that the compound exhibits specific spatial arrangements that can affect its biological activity and interactions with other molecules. Additionally, the compound's solubility, stability, and reactivity can vary significantly based on its molecular structure and the presence of functional groups. Overall, (S,S)-4,4'-diisopropyl-4,5,4',5'-tetrahydro[2.2]bioxazolyl represents a complex and interesting compound within the field of organic chemistry, with potential implications in medicinal chemistry and material science.
Formula:C12H20N2O2
InChI:InChI=1S/C12H20N2O2/c1-7(2)9-5-15-11(13-9)12-14-10(6-16-12)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10-/m1/s1
InChI key:ZSZOYMBXNYZPFL-NXEZZACHSA-N
SMILES:CC(C)[C@H]1COC(=N1)C2=N[C@H](CO2)C(C)C
Found 4 products.