CymitQuimica logo

CAS 1319716-42-1

:

1,1-Dimethylethyl 7-oxo-2-azaspiro[4.4]nonane-2-carboxylate

Description:
1,1-Dimethylethyl 7-oxo-2-azaspiro[4.4]nonane-2-carboxylate, identified by its CAS number 1319716-42-1, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the 7-oxo group indicates a ketone functionality, which can influence its chemical behavior, including reactivity in various organic reactions. The dimethyl substituents on the nitrogen atom enhance steric hindrance, potentially affecting the compound's interaction with other molecules. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, although specific applications would depend on detailed studies of its properties and interactions. Overall, the compound's unique structure and functional groups suggest a range of potential chemical behaviors and applications.
Formula:C13H21NO3
InChI:InChI=1S/C13H21NO3/c1-12(2,3)17-11(16)14-7-6-13(9-14)5-4-10(15)8-13/h4-9H2,1-3H3
InChI key:InChIKey=KVDDOJNQXATXQE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(CC1)CCC(=O)C2
Synonyms:
  • tert-Butyl 7-oxo-2-azaspiro[4.4]nonane-2-carboxylate
  • 1,1-Dimethylethyl 7-oxo-2-azaspiro[4.4]nonane-2-carboxylate
  • 2-Azaspiro[4.4]nonane-2-carboxylic acid, 7-oxo-, 1,1-dimethylethyl ester
Found 6 products.