CymitQuimica logo

CAS 132040-12-1

:

4-PHENYL-1H-PYRROLE-3-CARBOXYLIC ACID

Description:
4-Phenyl-1H-pyrrole-3-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a phenyl group at the 4-position and a carboxylic acid functional group at the 3-position contributes to its chemical reactivity and potential applications. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Its carboxylic acid group can participate in hydrogen bonding and can act as a weak acid, influencing its behavior in various chemical environments. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structural features allow for potential derivatization, which can enhance its properties or lead to the development of new materials. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c13-11(14)10-7-12-6-9(10)8-4-2-1-3-5-8/h1-7,12H,(H,13,14)
InChI key:IZAUZUSKFWENMY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CNC=C2C(=O)O
Found 4 products.