CymitQuimica logo

CAS 13210-52-1

:

1-(3-AMINO-PYRIDIN-4-YL)-ETHANONE

Description:
1-(3-Amino-pyridin-4-yl)-ethanone, with the CAS number 13210-52-1, is an organic compound characterized by the presence of a pyridine ring substituted with an amino group and an ethanone functional group. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for hydrogen bonding. The amino group (-NH2) enhances its reactivity and solubility in polar solvents, while the ethanone group (a ketone) introduces a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic addition. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in synthesizing more complex molecules or as intermediates in organic synthesis. Additionally, the presence of both the amino and carbonyl groups may allow for diverse interactions in biological systems, potentially influencing its pharmacological properties. Overall, this compound represents a versatile building block in organic and medicinal chemistry.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c1-5(10)6-2-3-9-4-7(6)8/h2-4H,8H2,1H3
InChI key:TUYHWJJUSYJFCK-UHFFFAOYSA-N
SMILES:CC(=O)c1ccncc1N
Synonyms:
  • 4-Acetyl-3-Aminopyridine
  • 1-(3-Amino-4-Pyridinyl)Ethanone
  • (3-Aminopyridin-4-yl)ethan-1-one
Found 4 products.