CymitQuimica logo

CAS 132172-61-3

:

dotap chloride

Description:
Dotap chloride, with the CAS number 132172-61-3, is a synthetic cationic lipid commonly used in the field of molecular biology and biochemistry, particularly for gene delivery applications. It is characterized by its ability to form liposomes, which can encapsulate nucleic acids and facilitate their transport into cells. Dotap chloride is known for its positive charge, which enhances its interaction with negatively charged cellular membranes, promoting cellular uptake. This lipid is often utilized in the formulation of lipid nanoparticles for mRNA delivery, making it a crucial component in the development of various therapeutic strategies, including vaccines. Additionally, dotap chloride exhibits good biocompatibility and low toxicity, making it a favorable choice for in vivo applications. Its structural properties, including hydrophobic and hydrophilic regions, contribute to its effectiveness in forming stable lipid bilayers. Overall, dotap chloride is a versatile and valuable tool in the advancement of gene therapy and other biotechnological applications.
Formula:C42H80ClNO4
InChI:InChI=1S/C42H80NO4.ClH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(44)46-39-40(38-43(3,4)5)47-42(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,40H,6-19,24-39H2,1-5H3;1H/q+1;/p-1/b22-20-,23-21-;
InChI key:KSXTUUUQYQYKCR-LQDDAWAPSA-M
SMILES:CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-]
Found 14 products.