CymitQuimica logo

CAS 132176-35-3

:

L-Aspartic acid, L-arginyl-L-arginyl-L-arginyl-L-α-aspartyl-L-α-aspartyl-L-α-aspartyl-L-seryl-L-α-aspartyl-L-α-aspartyl-

Description:
L-Aspartic acid, also known as aspartate, is a non-essential amino acid that plays a crucial role in the biosynthesis of proteins. It is characterized by its polar, hydrophilic nature due to the presence of a carboxyl group, which allows it to participate in various biochemical reactions. The compound you mentioned appears to be a complex peptide or polymer consisting of multiple L-arginine and L-aspartic acid residues, suggesting a structure that may exhibit unique properties related to its sequence and length. L-arginine is known for its role in protein synthesis and as a precursor to nitric oxide, a signaling molecule. The presence of multiple L-aspartic acid residues may enhance the molecule's solubility and reactivity. Such compounds can be involved in various biological functions, including neurotransmission and metabolic pathways. The CAS number 132176-35-3 identifies this specific compound, which may have applications in research or therapeutic contexts, although detailed studies would be necessary to fully understand its characteristics and potential uses.
Formula:C45H73N19O24
InChI:InChI=1S/C45H73N19O24/c46-17(4-1-7-53-43(47)48)33(78)56-18(5-2-8-54-44(49)50)34(79)57-19(6-3-9-55-45(51)52)35(80)58-20(10-27(66)67)36(81)59-21(11-28(68)69)37(82)61-24(14-31(74)75)40(85)64-26(16-65)41(86)62-22(12-29(70)71)38(83)60-23(13-30(72)73)39(84)63-25(42(87)88)15-32(76)77/h17-26,65H,1-16,46H2,(H,56,78)(H,57,79)(H,58,80)(H,59,81)(H,60,83)(H,61,82)(H,62,86)(H,63,84)(H,64,85)(H,66,67)(H,68,69)(H,70,71)(H,72,73)(H,74,75)(H,76,77)(H,87,88)(H4,47,48,53)(H4,49,50,54)(H4,51,52,55)/t17-,18-,19-,20-,21-,22-,23-,24-,25-,26-/m0/s1
InChI key:MROOTBWJKIXJEW-VPHKHLIQSA-N
SMILES:C(C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)N)CN=C(N)N
Synonyms:
  • L-Aspartic acid, L-arginyl-L-arginyl-L-arginyl-L-α-aspartyl-L-α-aspartyl-L-α-aspartyl-L-seryl-L-α-aspartyl-L-α-aspartyl-
Found 3 products.