CymitQuimica logo

CAS 13223-74-0

:

Acetamide, N-(5-methyl-3-isoxazolyl)-

Description:
Acetamide, N-(5-methyl-3-isoxazolyl)-, is an organic compound characterized by the presence of an acetamide functional group and a 5-methyl-3-isoxazole moiety. This compound features a nitrogen atom bonded to an acetyl group (–C(=O)NH2) and an isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the methyl group on the isoxazole ring contributes to its unique chemical properties. Acetamides generally exhibit moderate solubility in polar solvents due to their ability to form hydrogen bonds, and the isoxazole ring can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with isoxazole derivatives. Its specific reactivity and interactions would depend on the substituents and the overall molecular structure, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-4-3-6(8-10-4)7-5(2)9/h3H,1-2H3,(H,7,8,9)
InChI key:CUYZUESBPHQWRI-UHFFFAOYSA-N
SMILES:CC1=CC(=NO1)NC(=O)C
Found 4 products.