CymitQuimica logo

CAS 132242-52-5

:

1-Hydroxy-3-(3-methyl-2-butenyl)-4-[(1,4-dihydro-1,4-dioxonaphthalen)-2-yl]naphthalene-2-carboxylic acid methyl ester

Description:
1-Hydroxy-3-(3-methyl-2-butenyl)-4-[(1,4-dihydro-1,4-dioxonaphthalen)-2-yl]naphthalene-2-carboxylic acid methyl ester, with CAS number 132242-52-5, is a complex organic compound characterized by its multi-ring structure, which includes naphthalene and dioxonaphthalene moieties. This compound features a hydroxyl group and a carboxylic acid methyl ester, contributing to its potential reactivity and solubility properties. The presence of the 3-methyl-2-butenyl group suggests that it may exhibit unique steric and electronic properties, influencing its interactions in chemical reactions. The compound's structure indicates potential applications in fields such as organic synthesis, pharmaceuticals, or materials science, particularly due to its aromatic nature and functional groups that may participate in various chemical transformations. Additionally, its molecular complexity may allow for interesting biological activities, although specific biological properties would require further investigation. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications based on its unique structural features.
Formula:C27H22O6
InChI:InChI=1S/C27H22O6/c1-15(2)12-13-20-23(27(31)32-3)25(30)18-10-6-7-11-19(18)26(20)33-22-14-21(28)16-8-4-5-9-17(16)24(22)29/h4-12,14,30H,13H2,1-3H3
InChI key:UERDSCMBQADHGN-UHFFFAOYSA-N
SMILES:CC(=CCC1=C(C2=CC=CC=C2C(=C1C(=O)OC)O)OC3=CC(=O)C4=CC=CC=C4C3=O)C
Synonyms:
  • Rubioncolin C
  • 1-Hydroxy-3-(3-methyl-2-butenyl)-4-[(1,4-dihydro-1,4-dioxonaphthalen)-2-yl]naphthalene-2-carboxylic acid methyl ester
  • 2-Naphthalenecarboxylic acid, 4-[(1,4-dihydro-1,4-dioxo-2-naphthalenyl)oxy]-1-hydroxy-3-(3-methyl-2-buten-1-yl)-, methyl ester
Found 5 products.