CymitQuimica logo

CAS 13225-19-9

:

Methyl-4,6-di-O-benzylidene-2,3-di-O-benzyl-α-D-glucopyranoside

Description:
Methyl-4,6-di-O-benzylidene-2,3-di-O-benzyl-α-D-glucopyranoside is a complex glycoside derivative of glucose, characterized by multiple benzylidene and benzyl substituents. This compound features a glucopyranoside backbone, which is a six-membered cyclic form of glucose, modified at specific hydroxyl groups to enhance its stability and solubility. The presence of benzylidene groups contributes to its aromatic character, potentially influencing its reactivity and interaction with other molecules. This compound is often utilized in organic synthesis and carbohydrate chemistry, serving as a protective group for hydroxyl functionalities during various chemical transformations. Its structural complexity allows for diverse applications in medicinal chemistry and the development of glycosylated compounds. Additionally, the presence of methyl groups may enhance lipophilicity, affecting its biological activity and interaction with cellular targets. Overall, Methyl-4,6-di-O-benzylidene-2,3-di-O-benzyl-α-D-glucopyranoside exemplifies the intricate design of carbohydrate derivatives for specialized chemical applications.
Formula:C28H30O6
InChI:InChI=1S/C28H30O6/c1-29-28-26(31-18-21-13-7-3-8-14-21)25(30-17-20-11-5-2-6-12-20)24-23(33-28)19-32-27(34-24)22-15-9-4-10-16-22/h2-16,23-28H,17-19H2,1H3/t23-,24-,25+,26-,27?,28+/m1/s1
InChI key:CVHUOBYFXKHVJR-GUONBBAESA-N
SMILES:CO[C@@H]1[C@@H]([C@H]([C@H]2[C@H](O1)COC(O2)C3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5
Found 3 products.