CAS 13241-28-6: Chrysophanol 8-O-β-D-glucopyranoside
Description:Chrysophanol 8-O-β-D-glucopyranoside is a glycoside derived from chrysophanol, a natural compound found in various plants, particularly in the rhizomes of certain species like Rheum. This compound features a glucopyranoside moiety, which contributes to its solubility and biological activity. It is characterized by its yellowish color and is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. The presence of the glucopyranoside group enhances its stability and bioavailability, making it of interest in medicinal chemistry and natural product research. Chrysophanol 8-O-β-D-glucopyranoside is often studied for its effects on various biological pathways, and it may have applications in traditional medicine as well as in modern therapeutic contexts. Its CAS number, 13241-28-6, allows for easy identification and reference in scientific literature and databases. Overall, this compound exemplifies the intersection of natural product chemistry and pharmacology, highlighting the importance of plant-derived substances in drug discovery.
Formula:C21H20O9
InChI:InChI=1S/C21H20O9/c1-8-5-10-14(11(23)6-8)18(26)15-9(16(10)24)3-2-4-12(15)29-21-20(28)19(27)17(25)13(7-22)30-21/h2-6,13,17,19-23,25,27-28H,7H2,1H3/t13-,17-,19+,20-,21-/m1/s1
InChI key:InChIKey=WMMOMSNMMDMSRB-JNHRPPPUSA-N
SMILES:O=C1C=2C=CC=C(OC3OC(CO)C(O)C(O)C3O)C2C(=O)C4=C(O)C=C(C=C14)C
- Synonyms:
- Glucopyranoside, 8-hydroxy-6-methyl-1-anthraquinonyl
- 9,10-Anthracenedione, 8-(β-D-glucopyranosyloxy)-1-hydroxy-3-methyl-
- 8-(β-D-Glucopyranosyloxy)-1-hydroxy-3-methyl-9,10-anthracenedione
- Anthraquinone, 8-(β-D-glucopyranosyloxy)-1-hydroxy-3-methyl-
- Glucopyranoside, 8-hydroxy-6-methyl-1-anthraquinonyl, β-D-
