CymitQuimica logo

CAS 13250-82-3

:

3-Thiophenecarboxaldehyde ethylene acetal

Description:
3-Thiophenecarboxaldehyde ethylene acetal, with the CAS number 13250-82-3, is an organic compound characterized by its unique structure that includes a thiophene ring and an acetal functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the thiophene moiety, which contributes to its distinct odor and reactivity. The acetal group enhances its stability and influences its reactivity, particularly in condensation reactions. 3-Thiophenecarboxaldehyde ethylene acetal is often utilized in organic synthesis, serving as an intermediate in the production of various pharmaceuticals and agrochemicals. Its solubility in organic solvents makes it suitable for various applications in chemical research and industry. Additionally, the compound's properties may include moderate volatility and potential reactivity with nucleophiles, making it a valuable building block in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.
Formula:C7H8O2S
InChI:InChI=1/C7H8O2S/c1-4-10-5-6(1)7-8-2-3-9-7/h1,4-5,7H,2-3H2
InChI key:VOJKCZSSUHBMKS-UHFFFAOYSA-N
SMILES:c1cscc1C1OCCO1
Synonyms:
  • 1,3-Dioxolane, 2-(3-Thienyl)-
  • 2-(3-Thienyl)-1,3-dioxolane
  • 2-(Thiophen-3-Yl)-1,3-Dioxolane
Found 5 products.