CAS 132541-52-7

(Hydroxy-2-naphthalenylmethyl)phosphonic acid

Description:

(Hydroxy-2-naphthalenylmethyl)phosphonic acid, with the CAS number 132541-52-7, is a chemical compound characterized by its unique structure that includes a naphthalene moiety and a phosphonic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and phosphonic acids, such as stability under various conditions and potential reactivity due to the presence of the phosphonic acid group. It may be soluble in polar solvents, depending on the specific substituents and their interactions. The presence of the hydroxyl group contributes to its potential for hydrogen bonding, which can influence its solubility and reactivity. This compound may find applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its ability to interact with biological systems or act as a building block for more complex molecules. Its specific characteristics, such as melting point, boiling point, and reactivity, would require empirical data for precise determination.

Formula: C₁₁H₁₁O₄P

InChI: InChI=1S/C11H11O4P/c12-11(16(13,14)15)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11-12H,(H2,13,14,15)

InChI key: AMJJLDJPDLKNJA-UHFFFAOYSA-N

SMILES: C1=CC=C2C=C(C=CC2=C1)C(O)P(=O)(O)O

Synonyms:

• OH-Name-PA
• (Hydroxy-Naphthalen-2-Yl-Methyl)Phosphonic Acid

(Hydroxy-2-naphthylmethyl)phosphonic acid, 98%

CAS: 132541-52-7

A selective insulin receptor tyrosine kinase inhibitor

Formula: C₁₁H₁₁O₄P

Purity: 98%

Molecular weight: 238.18

Ref: 02-J63913

HNMPA

CAS: 132541-52-7

HNMPA blocks insulin receptor kinase, halting autophosphorylation; no impact on cAMP protein kinase or PKC.

Formula: C₁₁H₁₁O₄P

Purity: 99.18%

Color and Shape: Solid

Molecular weight: 238.18

Ref: TM-T21761

HNMPA

CAS: 132541-52-7

HNMPA

Formula: C₁₁H₁₁O₄P

Purity: 99%

Molecular weight: 238.18

Ref: 54-BUP12089

HNMPA

CAS: 132541-52-7

Formula: C₁₁H₁₁O₄P

Purity: 99.18%

Color and Shape: Solid

Molecular weight: 238.1764

Ref: IN-DA0010TK

Hydroxy(2-naphthyl)methanephosphonic Acid

Controlled Product

CAS: 132541-52-7

Applications Insulin receptor tyrosine kinase (IRTK) inhibitor.
References Ullrich, K., et al.: J. Pharmacol. Exper. Ther., 283, 1223 (1997), Deprez, P., et al.: Bioorg. Med. Chem. Lett., 12, 1295 (2002),

Formula: C₁₁H₁₁O₄P

Color and Shape: Neat

Molecular weight: 238.18

Ref: TR-H948575