CymitQuimica logo

CAS 132682-23-6

:

(4R)-4-(Hydroxymethyl)-2-oxazolidinone

Description:
(4R)-4-(Hydroxymethyl)-2-oxazolidinone, with the CAS number 132682-23-6, is a chemical compound characterized by its oxazolidinone structure, which features a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound typically exhibits a chiral center at the 4-position, contributing to its stereochemical properties. It is known for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive molecules. The hydroxymethyl group enhances its reactivity and solubility in polar solvents, making it useful in organic synthesis. Additionally, the oxazolidinone framework is significant in medicinal chemistry, often associated with antibiotic activity. The compound's stability, solubility, and reactivity can vary depending on the specific conditions, such as pH and temperature. Overall, (4R)-4-(Hydroxymethyl)-2-oxazolidinone represents a valuable structure in the development of therapeutic agents and serves as a key building block in organic synthesis.
Formula:C4H7NO3
InChI:InChI=1S/C4H7NO3/c6-1-3-2-8-4(7)5-3/h3,6H,1-2H2,(H,5,7)/t3-/m1/s1
InChI key:InChIKey=MEXGFDVEUOGVFI-GSVOUGTGSA-N
SMILES:C(O)[C@H]1NC(=O)OC1
Synonyms:
  • (R)-4-(Hydroxymethyl)oxazolidin-2-one
  • 2-Oxazolidinone, 4-(hydroxymethyl)-, (R)-
  • (4R)-4-(Hydroxymethyl)-2-oxazolidinone
  • 2-Oxazolidinone, 4-(hydroxymethyl)-, (4R)-
  • (4R)-4-(Hydroxymethyl)-1,3-oxazolidin-2-one
Found 5 products.