CAS 132684-60-7
:fmoc-L-tert-leucine
Description:
Fmoc-L-tert-leucine, with the CAS number 132684-60-7, is a protected form of the amino acid leucine, commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective moiety that allows for selective deprotection during the synthesis process, facilitating the assembly of peptides without interfering with the amino acid's reactivity. This compound features a tert-butyl side chain, which contributes to its hydrophobic characteristics, making it useful in the synthesis of peptides that require stability and solubility in organic solvents. Fmoc-L-tert-leucine is typically white to off-white in appearance and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its stability under standard laboratory conditions makes it a valuable reagent in organic chemistry and biochemistry, particularly in solid-phase peptide synthesis. Additionally, the Fmoc group can be removed under mild basic conditions, allowing for the subsequent coupling of other amino acids to form longer peptide chains.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-21(2,3)18(19(23)24)22-20(25)26-12-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17/h4-11,17-18H,12H2,1-3H3,(H,22,25)(H,23,24)/t18-/m1/s1
SMILES:CC(C)(C)[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-tBu-Gly-OH
- Fmoc-Tle-OH
- NALPHA-9-Fluorenylmethoxycarbonyl-L-tert-leucine
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-methyl-L-valine
- Fmoc-L-tert.leucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tert-leucine
CAS:Formula:C21H23NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:353.42Fmoc-tBu-Gly-OH
CAS:Building block for the synthesis of polytheonamides.Formula:C21H23NO4Purity:99.7%Color and Shape:White PowderMolecular weight:353.42L-Valine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-methyl-
CAS:Formula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.4116Fmoc-L-tert-leucine
CAS:Fmoc-L-tert-leucineFormula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.41162Fmoc-L-tert-leucine
CAS:Fmoc-L-tert-leucine is an amide that is used for the treatment of prostate cancer. Fmoc-L-tert-leucine has been shown to be effective in treating resistant prostate cancer cells in vivo, and it has been shown to inhibit the growth of prostate cancer cells in vitro. This drug also has a diagnostic effect on prostate cancer cells. The uptake of this drug by prostate cancer cells is dependent on the presence of caspase-9, which may be due to its ability to inhibit apoptosis.Formula:C21H23NO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:353.41 g/mol(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-dimethylbutanoic acid
CAS:Formula:C21H23NO4Purity:97%Color and Shape:White powderMolecular weight:353.418








