CAS 132715-69-6
:2-Bromo-3-fluorobenzoic acid
Description:
2-Bromo-3-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and fluorine substituents on the benzene ring. Specifically, the bromine atom is located at the second position and the fluorine atom at the third position relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is soluble in organic solvents. Its molecular structure contributes to its unique chemical properties, including its reactivity in electrophilic aromatic substitution reactions and potential applications in pharmaceuticals and agrochemicals. The presence of halogen atoms can influence the acidity of the carboxylic group, as well as the compound's overall polarity and lipophilicity. Additionally, 2-Bromo-3-fluorobenzoic acid can serve as an important intermediate in organic synthesis, facilitating the introduction of various functional groups. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit toxicity and environmental concerns.
Formula:C7H4BrFO2
InChI:InChI=1/C7H4BrFO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)
SMILES:c1cc(c(c(c1)F)Br)C(=O)O
Synonyms:- 3-Fluoro-2-bromobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-3-fluorobenzoic Acid
CAS:Formula:C7H4BrFO2Purity:>96.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:219.01Benzoic acid, 2-bromo-3-fluoro-
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.00792-Bromo-3-fluorobenzoic acid
CAS:2-Bromo-3-fluorobenzoic acidFormula:C7H4BrFO2Purity:98%Color and Shape:Solid-PowderMolecular weight:219.007862-Bromo-3-fluorobenzoic acid
CAS:2-Bromo-3-fluorobenzoic acid is a chemical compound that can be synthesized by the reduction of nitrobenzene with ammonium chloride. This reaction is regioselective, giving predominantly 2-bromo-3-fluorobenzoic acid. The reaction proceeds via a nucleophilic substitution mechanism and the product is formed in high yield. A second route for the synthesis of 2-bromo-3-fluorobenzoic acid involves the deamination of trifluorotoluene to produce hypophosphorous acid, which reacts with sulfuric acid to give 2-bromo-3-fluorobenzoic acid. The bromine atom in this molecule has a high nucleophilicity and reacts readily with electrophiles such as ammonia and amines.Formula:C7H4BrFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:219.01 g/mol2-Bromo-3-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:96%Color and Shape:Very pale yellow to pale reddish yellow powderMolecular weight:219.0092-Bromo-3-fluorobenzoic acid
CAS:2-Bromo-3-fluorobenzoic acidFormula:C7H4BrFO2Purity:98%Molecular weight:219.01





