CymitQuimica logo

CAS 132717-37-4

:

2,7-Dibromo-9-phenyl-9H-fluoren-9-ol

Description:
2,7-Dibromo-9-phenyl-9H-fluoren-9-ol is an organic compound characterized by its complex structure, which includes a fluorene backbone substituted with bromine and phenyl groups. This compound typically exhibits a high degree of stability due to the aromatic nature of its structure, which contributes to its potential applications in organic electronics and materials science. The presence of bromine atoms introduces significant polarity and can enhance reactivity, making it useful in various chemical reactions, including cross-coupling reactions. The hydroxyl (-OH) group in the structure can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence, which can be exploited in optoelectronic devices. Its synthesis and characterization often require advanced techniques such as NMR spectroscopy and mass spectrometry to confirm the presence of specific functional groups and the overall molecular structure. Overall, 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C19H12Br2O
InChI:InChI=1/C19H12Br2O/c20-13-6-8-15-16-9-7-14(21)11-18(16)19(22,17(15)10-13)12-4-2-1-3-5-12/h1-11,22H
InChI key:VGZUBRZNTWOSTO-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1(c2cc(ccc2c2ccc(cc12)Br)Br)O
Synonyms:
  • 9H-Fluoren-9-ol,2,7-dibromo-9-phenyl-
Found 4 products.