CAS 132765-35-6
:4,5-BIS(2-CYANOETHYLTHIO)-1,3-DITHIOL-2-THIONE
Description:
4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-thione, with the CAS number 132765-35-6, is a chemical compound characterized by its unique structure that includes two cyanoethylthio groups attached to a dithiol-thione framework. This compound typically exhibits properties associated with both thiol and thione functionalities, which can influence its reactivity and stability. It is likely to be a solid at room temperature and may have a relatively low solubility in water due to its hydrophobic thione groups. The presence of cyano groups suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in chemical reactions. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the cyano groups and the dithiol-thione system. Safety data should be consulted for handling, as compounds with thiol and cyano functionalities can pose health risks. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research fields.
Formula:C9H8N2S5
InChI:InChI=1/C9H8N2S5/c10-3-1-5-13-7-8(14-6-2-4-11)16-9(12)15-7/h1-2,5-6H2
SMILES:C(C#N)CSc1c(SCCC#N)sc(=S)s1
Synonyms:- Rarechem Ar Pa 0055
- 4,5-Bis(2'-Cyanoethylthio)-1,3-Dithiole-2-Thione
- 3-((5-[(2-Cyanoethyl)Thio]-2-Thioxo-1,3-Dithiol-4-Yl)Thio)Propanenitrile
- 4,5-Bis(2'-Cyanoethylthio)-1,3-Dithiole-2-Thione 97%
- 3,3'-[(2-Thioxo-1,3-Dithiole-4,5-Diyl)Disulfanediyl]Dipropanenitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5-Bis(2-cyanoethylthio)-1,3-dithiole-2-thione
CAS:Formula:C9H8N2S5Purity:>98.0%(HPLC)(N)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:304.48Propanenitrile, 3,3'-[(2-thioxo-1,3-dithiole-4,5-diyl)bis(thio)]bis-
CAS:Formula:C9H8N2S5Purity:98%Color and Shape:SolidMolecular weight:304.49824,5-Bis(2-cyanoethylthio)-1,3-dithiole-2-thione
CAS:<p>4,5-Bis(2-cyanoethylthio)-1,3-dithiole-2-thione is a fluorescent compound that exists in two orientations, cis and trans. It has been used as a linker for the construction of new compounds with interesting properties. 4,5-Bis(2-cyanoethylthio)-1,3-dithiole-2-thione has been shown to be an effective ligand for palladium cross coupling reactions. This compound can also be used in supramolecular chemistry due to its ability to fluoresce brightly.</p>Formula:C9H8N2S5Purity:Min. 95%Molecular weight:304.5 g/mol



