CymitQuimica logo

CAS 132873-57-5

:

(S)-(-)-A-methyl 4-nitrobenzylamine hydrochloride

Description:
(S)-(-)-A-methyl 4-nitrobenzylamine hydrochloride is a chiral organic compound characterized by its specific stereochemistry and functional groups. It features a methyl group and a nitro group attached to a benzylamine structure, which contributes to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, making it useful in various synthetic applications. As a hydrochloride salt, it is soluble in water, which is advantageous for its use in biological and pharmaceutical contexts. The compound's chirality indicates that it exists in two enantiomeric forms, with the (S)-(-) designation denoting the specific configuration that may impart distinct biological activity or pharmacological effects. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety and handling precautions should be observed due to the presence of the nitro group, which can be hazardous.
Formula:C8H11ClN2O2
InChI:InChI=1/C8H10N2O2.ClH/c1-6(9)7-2-4-8(5-3-7)10(11)12;/h2-6H,9H2,1H3;1H/t6-;/m0./s1
InChI key:CZQQGVFHLSBEDV-RGMNGODLSA-N
SMILES:C[C@@H](c1ccc(cc1)N(=O)=O)N.Cl
Synonyms:
  • (S)-1-(4-nitrophenyl)ethylamine hydro-chloride
  • (S)-alpha-Methyl-4-nitrobenzylamine hydrochloride
  • (1S)-1-(4-nitrophenyl)ethanamine hydrochloride
Found 6 products.