CymitQuimica logo

CAS 13292-05-2

:

3-bromo-9,10-phenanthrenequinone

Description:
3-Bromo-9,10-phenanthrenequinone is an organic compound characterized by its unique structure, which includes a phenanthrene backbone with a quinone functional group and a bromine substituent. This compound typically exhibits a deep color, often appearing as a dark solid or powder, due to its conjugated system that allows for extensive delocalization of electrons. It is known for its reactivity, particularly in electrophilic substitution reactions, owing to the presence of the electron-withdrawing quinone group. The bromine atom enhances its electrophilic character, making it a useful intermediate in organic synthesis. Additionally, 3-bromo-9,10-phenanthrenequinone may exhibit interesting photophysical properties, which can be exploited in various applications, including organic electronics and dye-sensitized solar cells. Its solubility is generally limited in polar solvents, but it may dissolve in non-polar organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards.
Formula:C14H7BrO2
InChI:InChI=1S/C14H7BrO2/c15-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13(16)14(11)17/h1-7H
InChI key:OFVPOKPVPJPQAY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1cc(ccc1C(=O)C2=O)Br
Synonyms:
  • 3-Bromo-9,10-phenanthrenedione
Found 5 products.