CAS 133-59-5: 2-Methylbenzenesulfonyl chloride
Description:2-Methylbenzenesulfonyl chloride, also known as toluenesulfonyl chloride, is an aromatic sulfonyl chloride characterized by the presence of a sulfonyl group (-SO2Cl) attached to a methyl-substituted benzene ring. This compound is typically a colorless to pale yellow liquid with a pungent odor. It is highly reactive, particularly with nucleophiles, making it a valuable reagent in organic synthesis for the introduction of sulfonyl groups into various substrates. The presence of the sulfonyl chloride functional group allows for the formation of sulfonamides and other derivatives through nucleophilic substitution reactions. Additionally, 2-Methylbenzenesulfonyl chloride is soluble in organic solvents such as dichloromethane and ether but reacts vigorously with water, releasing hydrochloric acid and forming the corresponding sulfonic acid. Due to its reactivity and potential hazards, including corrosiveness and toxicity, it should be handled with appropriate safety precautions in a well-ventilated environment.
Formula:C7H7ClO2S
InChI:InChI=1S/C7H7ClO2S/c1-6-4-2-3-5-7(6)11(8,9)10/h2-5H,1H3
InChI key:InChIKey=HDECRAPHCDXMIJ-UHFFFAOYSA-N
SMILES:O=S(=O)(Cl)C=1C=CC=CC1C
- Synonyms:
- 2-Methylbenzene-1-sulfonyl chloride
- 2-Methylbenzenesulfonyl Chloride
- 2-Methylphenylsulfonyl chloride
- 2-Toluenesulfonyl chloride
- Benzenesulfonyl chloride, 2-methyl-
- NSC 9354
- o-Methylbenzenesulfonyl chloride
- o-Toluenesulfonyl chloride
- o-Toluenesulphonyl chloride
- o-Tolylsulfonyl chloride
- See more synonyms
- o-Tosyl chloride

o-Toluenesulfonyl Chloride (contains ca. 23% isomer)
Ref: 3B-T0284
25g | 27.00 € | ||
500g | 122.00 € |

o-Toluenesulfonyl chloride, 80%
Ref: 02-L18983
5g | To inquire | ||
25g | To inquire |

2-Methylbenzenesulphonyl chloride
Ref: 54-OR9961
1g | 143.00 € | ||
5g | 203.00 € | ||
10g | 323.00 € |

2-Toluenesulfonyl chloride(contains ca.23% isomer)
Ref: 3D-FT164705
1kg | 525.00 € | ||
250g | 331.00 € | ||
500g | 349.00 € |

2-Toluenesulfonyl chloride, 95% min GC
Ref: 3D-FT179490
Undefined size | Discontinued | Request information |