CymitQuimica logo

CAS 133113-76-5

:

Phosphonic acid, 1,3-dithiol-2-yl-, dimethyl ester

Description:
Phosphonic acid, 1,3-dithiol-2-yl-, dimethyl ester, identified by CAS number 133113-76-5, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and dithiol moieties. This compound typically exhibits properties associated with phosphonic acids, such as high solubility in polar solvents and potential reactivity with nucleophiles due to the electrophilic nature of the phosphorus atom. The dimethyl ester functionality suggests that it can undergo hydrolysis to release phosphonic acid, which is known for its applications in agriculture as a herbicide and fungicide. Additionally, the presence of dithiol groups may impart unique chemical reactivity, including the ability to form chelates with metal ions or participate in redox reactions. The compound's structure may also influence its biological activity, making it of interest in medicinal chemistry and agrochemical research. Overall, this substance represents a class of compounds with diverse applications due to their chemical versatility and biological significance.
Formula:C5H9O3PS2
InChI:InChI=1S/C5H9O3PS2/c1-7-9(6,8-2)5-10-3-4-11-5/h3-5H,1-2H3
InChI key:ZQRMTDYBPMYORJ-UHFFFAOYSA-N
SMILES:COP(=O)(C1SC=CS1)OC
Found 4 products.