CAS 13323-66-5
:2′,4-Dihydroxychalcone
Description:
2′,4-Dihydroxychalcone is a flavonoid compound characterized by its structure, which consists of a chalcone backbone with hydroxyl groups at the 2' and 4 positions of the aromatic rings. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. It is soluble in organic solvents and has limited solubility in water, which is typical for many flavonoids. The presence of hydroxyl groups enhances its reactivity and ability to form hydrogen bonds, contributing to its biological activity. 2′,4-Dihydroxychalcone is often studied in the context of natural products and medicinal chemistry, as it may serve as a lead compound for the development of new therapeutic agents. Its synthesis can be achieved through various methods, including the condensation of appropriate aromatic aldehydes and ketones. Overall, this compound is of interest in both academic research and potential pharmaceutical applications.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c16-12-8-5-11(6-9-12)7-10-15(18)13-3-1-2-4-14(13)17/h1-10,16-17H
InChI key:InChIKey=FGPJTMCJNPRZGF-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=C(O)C=C1)(=O)C2=C(O)C=CC=C2
Synonyms:- (2E)-1-(2-hydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one
- 1-(2-Hydroxyphenyl)-3-(4-Hydroxyphenyl)Prop-2-En-1-One
- 2',4-Dihydroxychalcone
- 2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(4-hydroxyphenyl)-
- 2′,4-Dihydroxychalcone
- 3-(2-Hydroxyphenyl)-4-Hydroxyacrylophenone
- 4,2'-Dihydroxychalcone
- Chalcone, 2′,4-dihydroxy-
- NSC 73255
- 1-(2-Hydroxyphenyl)-3-(4-hydroxyphenyl)-2-propen-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(4-hydroxyphenyl)-
CAS:Formula:C15H12O3Purity:95%Color and Shape:SolidMolecular weight:240.25402',4-Dihydroxychalcone
CAS:2',4-DihydroxychalconeFormula:C15H12O3Purity:95%Molecular weight:240.253984,2'-Dihydroxychalcone
CAS:4,2'-Dihydroxychalcone is a bioactive flavonoid compound, which is typically derived from a variety of plant sources. As a member of the chalcones, it exhibits a diverse range of biological activities. The mode of action of 4,2'-Dihydroxychalcone involves the modulation of cellular pathways, primarily through its antioxidant properties. It effectively scavenges free radicals, thus protecting cells from oxidative stress. Additionally, it exerts anti-inflammatory effects by inhibiting specific signaling pathways related to inflammation.Formula:C15H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:240.25 g/mol1-(2-Hydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one
CAS:1-(2-Hydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-oneFormula:C15H12O3Purity:95%Molecular weight:240.25




