CymitQuimica logo

CAS 1333002-37-1

:

1-Bromo-N-phenylcarbazole

Description:
1-Bromo-N-phenylcarbazole is an organic compound characterized by the presence of a bromine atom attached to a carbazole structure, which is a fused bicyclic compound consisting of a phenyl group and a nitrogen-containing heterocycle. This compound typically exhibits properties such as moderate solubility in organic solvents and may demonstrate fluorescence, making it of interest in materials science and organic electronics. The bromine substituent can influence its reactivity, particularly in electrophilic aromatic substitution reactions, and can also serve as a site for further functionalization. Additionally, the presence of the phenyl group contributes to the compound's stability and electronic properties. 1-Bromo-N-phenylcarbazole may be utilized in various applications, including organic light-emitting diodes (OLEDs), as well as in the synthesis of other complex organic molecules. Its unique structure and properties make it a subject of interest in both synthetic organic chemistry and materials research.
Formula:C18H12BrN
InChI:InChI=1S/C18H12BrN/c19-16-11-6-10-15-14-9-4-5-12-17(14)20(18(15)16)13-7-2-1-3-8-13/h1-12H
InChI key:AELBZZMQJAJEJW-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)N2C3=CC=CC=C3C4=C2C(=CC=C4)Br
Found 5 products.