CAS 13331-23-2
:2-Furanboronic acid
Description:
2-Furanboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a furan ring. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. The compound features a boron atom bonded to a hydroxyl group and an aromatic furan ring, which contributes to its reactivity and potential applications in organic synthesis. 2-Furanboronic acid is known for its ability to form stable complexes with diols, making it useful in various chemical reactions, including Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, it has potential applications in medicinal chemistry and materials science due to its unique structural properties. The compound is sensitive to moisture and should be handled with care to maintain its stability. Overall, 2-furanboronic acid is a versatile building block in organic chemistry, facilitating the development of complex molecular architectures.
Formula:C4H5BO3
InChI:InChI=1/C4H5BO3/c6-5(7)4-2-1-3-8-4/h1-3,6-7H
SMILES:c1cc(B(O)O)oc1
Synonyms:- Furan-2-Boronic Acid
- Akos 90301
- Akos Brn-0264
- 2-Furylboronic Acid
- 2-Furanylboronic Acid
- Rarechem Ah Pb 0259
- Timtec-Bb Sbb004326
- Furan-2-Ylboronic Acid
- 2-FURANBORONIC ACID
- Furane-2-boronicacid
- Furan-2-boronic acid, 2-furylboronic acid
- 2-Furaneboronicacid
- (2-Furyl)boranediol
- (2-Furyl)dihydroxyborane
- Dihydroxy(2-furanyl)borane
- 2-Furylboronic Acid (contains varying amounts of Anhydride)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Furylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C4H5BO3Purity:97.0 to 119.0 %Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:111.89Furan-2-boronic acid, 97%
CAS:It is used in Suzuki reaction for generalized route for the synthesis of -furyl-,-unsaturated aldehydes. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AFormula:C4H5BO3Purity:97%Color and Shape:Crystals or powder or crystalline powder, Pale cream to creamMolecular weight:111.89Furan-2-boronic acid
CAS:Furan-2-boronic acidFormula:C4H5BO3Purity:98%Color and Shape:Off-white SolidMolecular weight:111.89169Furan-2-boronic acid
CAS:Formula:C4H5BO3Purity:98%Color and Shape:Powder or Crystalline Powder or Solid or ChunksMolecular weight:111.89Ref: 10-F010999
1kgTo inquire1g9.00€5g21.00€10g32.00€15g42.00€25g60.00€50g100.00€100g186.00€500g802.00€Furan-2-boronic acid
CAS:Controlled ProductApplications Furan-2-boronic acid
Formula:C4H5BO3Color and Shape:NeatMolecular weight:111.89





