CymitQuimica logo

CAS 1333222-34-6

:

Ethyl 4-amino-1-[(1,1-dimethylethoxy)carbonyl]-4-piperidineacetate

Description:
Ethyl 4-amino-1-[(1,1-dimethylethoxy)carbonyl]-4-piperidineacetate is a chemical compound characterized by its complex structure, which includes a piperidine ring, an amino group, and an ethyl ester functional group. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The presence of the dimethylethoxycarbonyl group suggests that it may be involved in various chemical reactions, particularly in the synthesis of more complex molecules. Its molecular structure indicates that it may exhibit properties such as solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the piperidine ring and the ester group. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any risks associated with its use.
Formula:C14H26N2O4
InChI:InChI=1S/C14H26N2O4/c1-5-19-11(17)10-14(15)6-8-16(9-7-14)12(18)20-13(2,3)4/h5-10,15H2,1-4H3
InChI key:InChIKey=SZMBLZJHDPDRPH-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1(N)CCN(C(OC(C)(C)C)=O)CC1
Synonyms:
  • Ethyl 4-amino-1-[(1,1-dimethylethoxy)carbonyl]-4-piperidineacetate
  • 4-Piperidineacetic acid, 4-amino-1-[(1,1-dimethylethoxy)carbonyl]-, ethyl ester
  • tert-Butyl 4-amino-4-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate
Found 2 products.