CAS 1334177-79-5
:25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid
Description:
The chemical substance known as "25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid" with CAS number 1334177-79-5 is a complex organic compound characterized by its unique structural features, including multiple functional groups and a long carbon chain. It contains a pyrrole derivative, which contributes to its potential biological activity, and several ether linkages due to the presence of multiple oxygen atoms in its structure. The presence of both oxo and carboxylic acid functionalities suggests that it may exhibit acidic properties and could participate in various chemical reactions, including esterification or amidation. This compound may be of interest in medicinal chemistry or materials science due to its potential applications in drug delivery systems or as a building block for more complex molecules. However, specific information regarding its solubility, stability, and reactivity would require further experimental investigation.
Formula:C22H36N2O11
InChI:InChI=1S/C22H36N2O11/c25-19(3-6-24-20(26)1-2-21(24)27)23-5-8-31-10-12-33-14-16-35-18-17-34-15-13-32-11-9-30-7-4-22(28)29/h1-2H,3-18H2,(H,23,25)(H,28,29)
InChI key:InChIKey=WKTGEZMXNNBFEZ-UHFFFAOYSA-N
SMILES:C(CC(NCCOCCOCCOCCOCCOCCOCCC(O)=O)=O)N1C(=O)C=CC1=O
Synonyms:- 25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid
- 4,7,10,13,16,19-Hexaoxa-22-azapentacosanoic acid, 25-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Mal-amido-PEG6-acid
CAS:Mal-amido-PEG6-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C22H36N2O11Color and Shape:SolidMolecular weight:504.531-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22-hexaoxa-4-azapentacosan-25-oic acid
CAS:Purity:97%Molecular weight:504.5329895Mal-PEG6-COOH
CAS:<p>Mal-PEG6-COOH is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Mal-PEG6-COOH is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.</p>Formula:C22H36N2O11Purity:Min. 95%Molecular weight:504.53 g/molMAL dPEG®6-Acid
CAS:<p>MAL dPEG®6-Acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. MAL dPEG®6-Acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.</p>Formula:C22H36N2O11Purity:Min. 95%Molecular weight:504.53 g/mol




