CymitQuimica logo

CAS 1334177-79-5

:

25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid

Description:
The chemical substance known as "25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid" with CAS number 1334177-79-5 is a complex organic compound characterized by its unique structural features, including multiple functional groups and a long carbon chain. It contains a pyrrole derivative, which contributes to its potential biological activity, and several ether linkages due to the presence of multiple oxygen atoms in its structure. The presence of both oxo and carboxylic acid functionalities suggests that it may exhibit acidic properties and could participate in various chemical reactions, including esterification or amidation. This compound may be of interest in medicinal chemistry or materials science due to its potential applications in drug delivery systems or as a building block for more complex molecules. However, specific information regarding its solubility, stability, and reactivity would require further experimental investigation.
Formula:C22H36N2O11
InChI:InChI=1S/C22H36N2O11/c25-19(3-6-24-20(26)1-2-21(24)27)23-5-8-31-10-12-33-14-16-35-18-17-34-15-13-32-11-9-30-7-4-22(28)29/h1-2H,3-18H2,(H,23,25)(H,28,29)
InChI key:InChIKey=WKTGEZMXNNBFEZ-UHFFFAOYSA-N
SMILES:C(CC(NCCOCCOCCOCCOCCOCCOCCC(O)=O)=O)N1C(=O)C=CC1=O
Synonyms:
  • 25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid
  • 4,7,10,13,16,19-Hexaoxa-22-azapentacosanoic acid, 25-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-
Found 7 products.