CAS 13343-67-4
:Phenylmethyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside
Description:
Phenylmethyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside, also known by its CAS number 13343-67-4, is a glycoside derivative of glucopyranose. This compound features a phenylmethyl group, which contributes to its aromatic characteristics, and an acetylamino group that enhances its solubility and reactivity. The presence of the 2-deoxy configuration indicates that it lacks a hydroxyl group at the second carbon, which is significant for its biological activity and interaction with enzymes. This compound is typically white to off-white in appearance and is soluble in polar solvents, making it suitable for various biochemical applications. Its structure suggests potential roles in medicinal chemistry, particularly in the development of glycosylated drugs or as a substrate for glycosyltransferases. Additionally, the acetylamino group may impart specific biological properties, such as improved membrane permeability or altered binding affinity to biological targets. Overall, this compound is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C15H21NO6
InChI:InChI=1S/C15H21NO6/c1-9(18)16-12-14(20)13(19)11(7-17)22-15(12)21-8-10-5-3-2-4-6-10/h2-6,11-15,17,19-20H,7-8H2,1H3,(H,16,18)/t11-,12-,13-,14-,15-/m1/s1
InChI key:InChIKey=SKOZFDIGKDPQBO-KJWHEZOQSA-N
SMILES:O(CC1=CC=CC=C1)[C@H]2[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O2
Synonyms:- Glucopyranoside, benzyl 2-acetamido-2-deoxy-, β-D-
- β-D-Glucopyranoside, benzyl 2-acetamido-2-deoxy-
- Phenylmethyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside
- β-D-Glucopyranoside, phenylmethyl 2-(acetylamino)-2-deoxy-
- Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside
CAS:Benzyl 2-acetamido-2-deoxy-β-D-glucopyranosideFormula:C15H21NO6Color and Shape:SolidMolecular weight:311.33033Benzyl 2-Acetamido-2-deoxy-β-D-glucopyranoside
CAS:Formula:C15H21NO6Purity:95.0%Color and Shape:SolidMolecular weight:311.3303Benzyl 2-Acetamido-2-deoxy-β-D-glucopyranoside
CAS:Formula:C15H21NO6Purity:>95.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:311.33Benzyl 2-acetamido-2-deoxy-b-D-glucopyranoside
CAS:The family of sporadically occurring benzyl 2-acetamido-2-deoxy-b-D-glucopyranoside is characterized by chromosome terminal deletions, cytogenetic abnormalities, and phenotypes. The sporadically occurring benzyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a member of the glucosamine family. It is characterized by chromosome terminal deletions, cytogenetic abnormalities, and phenotypes.Formula:C15H21NO6Purity:Min. 95%Color and Shape:White PowderMolecular weight:311.33 g/molBenzyl 2-Acetamido-2-deoxy-β-D-glucopyranoside
CAS:Controlled ProductFormula:C15H21NO6Color and Shape:NeatMolecular weight:311.33





