CymitQuimica logo

CAS 13349-91-2

:

Piperazine, 1-(2,2,2-trifluoroethyl)-, hydrochloride (1:2)

Description:
Piperazine, 1-(2,2,2-trifluoroethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for various applications, including pharmaceuticals. The trifluoroethyl substituent can impart unique properties, such as increased metabolic stability and altered pharmacokinetics. This compound may exhibit potential as a pharmaceutical agent, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its molecular structure suggests that it could interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity. Overall, the characteristics of this compound make it a subject of interest in both research and industrial applications.
Formula:C6H11F3N2·2ClH
InChI:InChI=1S/C6H11F3N2.2ClH/c7-6(8,9)5-11-3-1-10-2-4-11;;/h10H,1-5H2;2*1H
InChI key:InChIKey=FZNSAOHSKTXHEJ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)N1CCNCC1.Cl
Synonyms:
  • 4-(2,2,2-Trifluoroethyl)piperazine bishydrochloride
  • Piperazine, 1-(2,2,2-trifluoroethyl)-, dihydrochloride
  • Piperazine, 1-(2,2,2-trifluoroethyl)-, hydrochloride (1:2)
  • 1-(2,2,2-Trifluoroethyl)piperazine dihydrochloride
Found 4 products.