CymitQuimica logo

CAS 13360-61-7

:

1-Pentadecene

Description:
1-Pentadecene is an unsaturated hydrocarbon belonging to the alkene family, characterized by the presence of a carbon-carbon double bond. Its molecular formula is C15H30, indicating it consists of 15 carbon atoms and 30 hydrogen atoms. This compound is a linear chain alkene, meaning its carbon atoms are arranged in a straight chain. 1-Pentadecene is typically a colorless liquid at room temperature and exhibits a relatively low viscosity. It is insoluble in water but soluble in organic solvents, which is common for hydrocarbons. The presence of the double bond gives it unique reactivity, allowing it to participate in various chemical reactions, such as polymerization and hydrogenation. 1-Pentadecene is often used in organic synthesis and as a precursor in the production of surfactants and lubricants. Additionally, it can be found in certain natural oils and is of interest in the study of fatty acid derivatives. Its properties make it relevant in both industrial applications and research settings.
Formula:C15H30
InChI:InChI=1S/C15H30/c1-3-5-7-9-11-13-15-14-12-10-8-6-4-2/h3H,1,4-15H2,2H3
InChI key:InChIKey=PJLHTVIBELQURV-UHFFFAOYSA-N
SMILES:C(CCCCCCC)CCCCCC=C
Synonyms:
  • 1-Pentadecene
  • NSC 77125
Found 8 products.