CymitQuimica logo

CAS 133803-81-3

:

Propanoic acid, 3-[2-(2-hydroxyethoxy)ethoxy]-, 1,1-dimethylethyl ester

Description:
Propanoic acid, 3-[2-(2-hydroxyethoxy)ethoxy]-, 1,1-dimethylethyl ester, identified by CAS number 133803-81-3, is an organic compound characterized by its ester functional group. This compound features a propanoic acid backbone, which contributes to its carboxylic acid properties, while the presence of the 1,1-dimethylethyl group enhances its steric bulk and hydrophobic characteristics. The ethoxy groups in the structure provide additional hydrophilicity, which can influence its solubility in various solvents. Typically, esters like this one exhibit moderate volatility and can participate in various chemical reactions, including hydrolysis and transesterification. The compound may also display biological activity, making it of interest in pharmaceutical and agricultural applications. Its molecular structure suggests potential uses in formulations where both hydrophilic and hydrophobic properties are advantageous, such as in emulsifiers or surfactants. Overall, the unique combination of functional groups in this ester contributes to its diverse chemical behavior and potential applications.
Formula:C11H22O5
InChI:InChI=1S/C11H22O5/c1-11(2,3)16-10(13)4-6-14-8-9-15-7-5-12/h12H,4-9H2,1-3H3
InChI key:OKOWESVURLUVMD-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)CCOCCOCCO
Found 6 products.