CAS 13395-02-3: Aristolactam
Description:Aristolactam, with the CAS number 13395-02-3, is a chemical compound that belongs to the class of lactams, which are cyclic amides. It is characterized by its structural features, including a fused ring system that contributes to its unique chemical properties. Aristolactam is often studied for its potential biological activities, including its role in various pharmacological applications. The compound may exhibit specific reactivity patterns typical of lactams, such as nucleophilic attack at the carbonyl carbon, which can lead to the formation of various derivatives. Additionally, aristolactam has been investigated for its potential mutagenic properties, making it of interest in toxicological studies. Its solubility, stability, and interaction with biological systems can vary based on environmental conditions and the presence of other chemical species. Overall, aristolactam serves as a significant subject of research in both organic chemistry and medicinal chemistry, highlighting the importance of understanding its characteristics for potential applications.
Formula:C17H11NO4
InChI:InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19)
InChI key:InChIKey=MXOKGWUJNGEKBH-UHFFFAOYSA-N
SMILES:O=C1NC=2C=C3C(OC)=CC=CC3=C4C=5OCOC5C=C1C24
- Synonyms:
- 8-Methoxybenzo[f]-1,3-benzodioxolo[6,5,4-cd]indol-5(6H)-one
- 8-methoxy[1,3]benzodioxolo[6,5,4-cd]benzo[f]indol-5(6H)-one
- Aristolactam
- Aristololactam
- Aristololactam I
- Benzo[f]-1,3-benzodioxolo[6,5,4-cd]indol-5(6H)-one, 8-methoxy-
- NSC 87406
- Aristolactam I
