CAS 13395-02-3
:Aristolactam
Description:
Aristolactam, with the CAS number 13395-02-3, is a chemical compound that belongs to the class of lactams, which are cyclic amides. It is characterized by its structural features, including a fused ring system that contributes to its unique chemical properties. Aristolactam is often studied for its potential biological activities, including its role in various pharmacological applications. The compound may exhibit specific reactivity patterns typical of lactams, such as nucleophilic attack at the carbonyl carbon, which can lead to the formation of various derivatives. Additionally, aristolactam has been investigated for its potential mutagenic properties, making it of interest in toxicological studies. Its solubility, stability, and interaction with biological systems can vary based on environmental conditions and the presence of other chemical species. Overall, aristolactam serves as a significant subject of research in both organic chemistry and medicinal chemistry, highlighting the importance of understanding its characteristics for potential applications.
Formula:C17H11NO4
InChI:InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19)
InChI key:InChIKey=MXOKGWUJNGEKBH-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=4C(C=C3N1)=C(OC)C=CC4)C5=C(C2)OCO5
Synonyms:- 8-Methoxybenzo[f]-1,3-benzodioxolo[6,5,4-cd]indol-5(6H)-one
- 8-methoxy[1,3]benzodioxolo[6,5,4-cd]benzo[f]indol-5(6H)-one
- Aristolactam
- Aristololactam
- Aristololactam I
- Benzo[f]-1,3-benzodioxolo[6,5,4-cd]indol-5(6H)-one, 8-methoxy-
- NSC 87406
- Aristolactam I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Ref: IN-DA009FOP
50mgTo inquire100mgTo inquire250mgTo inquire1mg85.00€5mg150.00€10mg214.00€25mg626.00€Aristolactam I (Standard)
CAS:Aristolactam I (Standard) is a reference standard for research and analysis in studies involving Aristolactam I. 1.Aristolactam I (Aristololactum) has cytotoxic potency, mediated through the induction of apoptosis in a caspase 3-dependent pathway. 2. The effects of Aristololactam I may be mediated by different mechanisms except TGF-beta1 pathway. 3. Aristololactam I may be one of toxic metabolites in Chinese herbs containing AA which participate in renal damage and fibrosis.Formula:C17H11NO4Color and Shape:SolidMolecular weight:293.27Aristolactam I
CAS:8-Methoxy-[1,3]dioxolo[4',5':4,5]benzo[1,2,3-cd]benzo[f]indol-5(6H)-oneFormula:C17H11NO4Purity:98%Molecular weight:293.27Aristolactam I
CAS:Aristolactam I (Aristololactum) has cytotoxic potency, mediated through the induction of apoptosis in a caspase 3-dependent pathway.Formula:C17H11NO4Purity:98.98% - 99.96%Color and Shape:Yellow SolidMolecular weight:293.27Ref: TM-T3S1227
1mg57.00€5mg133.00€1mL*10mM (DMSO)172.00€10mg205.00€25mg350.00€50mg515.00€100mg735.00€Aristolactam
CAS:LactamsFormula:C17H11NO4Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:293.28Aristolactam
CAS:Aristolactam is a naturally occurring alkaloid, which is derived from the Aristolochia genus of plants. This compound belongs to a class of heterocyclic aromatic compounds known for their intricate structures and biological activities. The biosynthesis of aristolactam occurs within plants primarily as a defense mechanism against herbivores and pathogens.
Formula:C17H11NO4Purity:Min. 95%Color and Shape:Yellow SolidMolecular weight:293.27 g/mol
