CymitQuimica logo

CAS 13402-32-9

:

1,3-Dibromo-2-nitrobenzene

Description:
1,3-Dibromo-2-nitrobenzene is an aromatic compound characterized by the presence of two bromine atoms and one nitro group attached to a benzene ring. The bromine substituents are located at the 1 and 3 positions, while the nitro group is at the 2 position, resulting in a complex molecular structure that influences its chemical reactivity and physical properties. This compound typically appears as a yellow to brown solid and is known for its moderate solubility in organic solvents, such as ethanol and acetone, but limited solubility in water. It exhibits properties typical of halogenated nitrobenzenes, including potential applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Additionally, 1,3-dibromo-2-nitrobenzene may pose environmental and health risks, necessitating careful handling and disposal due to its potential toxicity and reactivity. As with many nitro compounds, it can undergo reduction reactions, leading to various derivatives that may have different biological activities.
Formula:C6H3Br2NO2
InChI:InChI=1/C6H3Br2NO2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H
InChI key:HATHNBZPXBWLFB-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)Br)N(=O)=O)Br
Synonyms:
  • Benzene, 1,3-Dibromo-2-Nitro-
  • 2,6-Dibromonitrobenzene
Found 4 products.