CymitQuimica logo

CAS 1340593-59-0

:

Oteseconazole

Description:
Oteseconazole is a novel antifungal agent primarily developed for the treatment of fungal infections, particularly those caused by Candida species. It belongs to the class of triazole antifungals, which function by inhibiting the synthesis of ergosterol, an essential component of fungal cell membranes. This mechanism disrupts cell membrane integrity, leading to cell death. Oteseconazole has demonstrated broad-spectrum activity against various fungi, including those resistant to other antifungal treatments. Its pharmacokinetic profile suggests favorable absorption and distribution characteristics, allowing for effective systemic treatment. Additionally, it has been studied for its potential in treating conditions like vulvovaginal candidiasis. The compound is characterized by its specific molecular structure, which contributes to its efficacy and safety profile. As with many antifungal agents, potential side effects may include gastrointestinal disturbances and liver enzyme elevations, necessitating monitoring during treatment. Overall, oteseconazole represents a promising addition to the antifungal arsenal, particularly in the context of increasing antifungal resistance.
Formula:C23H16F7N5O2
InChI:InChI=1S/C23H16F7N5O2/c24-16-4-7-18(19(25)9-16)21(36,11-35-13-32-33-34-35)23(29,30)20-8-3-15(10-31-20)14-1-5-17(6-2-14)37-12-22(26,27)28/h1-10,13,36H,11-12H2/t21-/m0/s1
InChI key:IDUYJRXRDSPPRC-NRFANRHFSA-N
SMILES:C1=CC(=CC=C1C2=CN=C(C=C2)C([C@](CN3C=NN=N3)(C4=C(C=C(C=C4)F)F)O)(F)F)OCC(F)(F)F
Synonyms:
  • 2-Pyridineethanol, α-(2,4-difluorophenyl)-β,β-difluoro-α-(1H-tetrazol-1-ylmethyl)-5-[4-(2,2,2-trifluoroethoxy)phenyl]-, (αR)-
Found 10 products.