CymitQuimica logo

CAS 1341037-74-8

:

Piperidine, 4-(cyclobutyloxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(cyclobutyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a cyclobutyloxy substituent at the 4-position of the piperidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The presence of the cyclobutyl group may influence its lipophilicity and overall pharmacokinetic profile. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, including stability, reactivity, and potential applications in various fields.
Formula:C9H17NO·ClH
InChI:InChI=1S/C9H17NO.ClH/c1-2-8(3-1)11-9-4-6-10-7-5-9;/h8-10H,1-7H2;1H
InChI key:InChIKey=LQJCCIPEZZZZDJ-UHFFFAOYSA-N
SMILES:O(C1CCNCC1)C2CCC2.Cl
Synonyms:
  • Piperidine, 4-(cyclobutyloxy)-, hydrochloride (1:1)
Found 3 products.