CAS 13433-09-5: L-Aspartyl-L-phenylalanine
Description:L-Aspartyl-L-phenylalanine, commonly known as aspartame, is a low-calorie artificial sweetener widely used in food and beverage products. It is a dipeptide composed of the amino acids L-aspartic acid and L-phenylalanine, linked by a peptide bond. This compound is characterized by its sweet taste, which is approximately 200 times sweeter than sucrose, making it an effective sugar substitute. Aspartame is stable under acidic conditions but can degrade when exposed to high temperatures or prolonged storage, which may limit its use in certain cooking applications. It is soluble in water, which enhances its utility in various formulations. However, individuals with phenylketonuria (PKU), a genetic disorder, must avoid aspartame due to its phenylalanine content, as they cannot metabolize this amino acid properly. Aspartame is generally recognized as safe by regulatory agencies when consumed within established acceptable daily intake levels. Its widespread use in diet sodas, sugar-free products, and various food items has made it a significant component of the modern food industry.
Formula:C13H16N2O5
InChI:InChI=1S/C13H16N2O5/c14-9(7-11(16)17)12(18)15-10(13(19)20)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,14H2,(H,15,18)(H,16,17)(H,19,20)/t9-,10-/m0/s1
InChI key:InChIKey=YZQCXOFQZKCETR-UWVGGRQHSA-N
SMILES:O=C(O)CC(N)C(=O)NC(C(=O)O)CC=1C=CC=CC1
- Synonyms:
- α-L-Aspartyl-L-phenylalanine
- L-Phenylalanine, N-L-α-aspartyl-
- L-α-Aspartyl-L-phenylalanine
- Succinamic acid, 3-amino-N-(α-carboxyphenethyl)-, stereoisomer
- L-Phenylalanine, L-α-aspartyl-
