CymitQuimica logo

CAS 134391-02-9

:

Methanesulfonamide,N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]-

Description:
Methanesulfonamide, N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanesulfonamide group and a substituted phenyl ring. The presence of dichloro and difluoromethyl groups indicates that it has significant halogenation, which can influence its reactivity and biological activity. This compound is likely to exhibit properties typical of sulfonamides, such as antimicrobial activity, due to the sulfonamide functional group. The triazole moiety suggests potential applications in pharmaceuticals, particularly in antifungal or antibacterial agents. Its molecular structure may also confer stability and solubility characteristics that are relevant for formulation in various chemical environments. The specific arrangement of substituents can affect its interaction with biological targets, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the intricate design often found in drug development, where modifications to the molecular framework can lead to enhanced efficacy and selectivity.
Formula:C10H8Cl2F2N4O3S
InChI:InChI=1S/C10H8Cl2F2N4O3S/c1-22(20,21)16-7-3-8(6(12)2-5(7)11)18-10(19)17(4-15-18)9(13)14/h2-4,9,16H,1H3
InChI key:IPZJLGDHAGKUSR-UHFFFAOYSA-N
SMILES:CS(=O)(=O)NC1=CC(=C(C=C1Cl)Cl)N2C(=O)N(C=N2)C(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.