CAS 134612-80-9: 3-METHOXY-4-HYDROXY-5-NITROBENZYL,4'-METHYLBENZYL KETONE
Description:3-Methoxy-4-hydroxy-5-nitrobenzyl, 4'-methylbenzyl ketone, identified by its CAS number 134612-80-9, is an organic compound characterized by its complex structure, which includes a methoxy group, a hydroxy group, and a nitro group attached to a benzyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of functional groups like methoxy and hydroxy can influence its solubility in polar solvents, while the nitro group may impart unique reactivity and electronic properties. Additionally, the ketone functional group contributes to its potential as a precursor in organic synthesis. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C15H13NO5
InChI:InChI=1/C15H13NO5/c1-9-3-5-10(6-4-9)14(17)11-7-12(16(19)20)15(18)13(8-11)21-2/h3-8,18H,1-2H3
- Synonyms:
- 3-O-methyltolcapone
- (4-Hydroxy-3-Methoxy-5-Nitrophenyl)(4-Methylphenyl)Methanone

Tolcapone Related Compound B (4-hydroxy-3-methoxy-4'-methyl-5-nitrobenzophenone)
Ref: 45-1670229
25mg | 1,357.00 € |

3-METHOXY-4-HYDROXY-5-NITROBENZYL,4'-METHYLBENZYL KETONE
Ref: IN-DA009F47
100mg | 141.00 € |

3-O-Methyl Tolcapone
Ref: 4Z-T-154
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

4-Hydroxy-3-methoxy-4'-methyl-5-nitrobenzophenone
Controlled ProductRef: 86-MM3329.01
25mg | To inquire | ||
4x25mg | To inquire |

4-Hydroxy-3-methoxy-4'-methyl-5-nitrobenzophenone
Controlled ProductRef: 86-MM3329.01-0025
25mg | To inquire | ||
4x25mg | To inquire |

(4-Hydroxy-3-methoxy-5-nitrophenyl)(p-tolyl)methanone
Ref: 10-F429833
1g | To inquire | ||
250mg | To inquire |

3-O-Methyl tolcapone
Controlled ProductRef: 3D-FM25570
5mg | 147.00 € | ||
10mg | 175.00 € | ||
25mg | 225.00 € | ||
50mg | 395.00 € | ||
100mg | 691.00 € |

3-O-Methyltolcapone
Ref: TM-T10119
25mg | 1,444.00 € | ||
50mg | 1,882.00 € | ||
100mg | 2,375.00 € |

3-O-Methyl Tolcapone-d4
Controlled ProductRef: TR-M330892
25mg | 1,904.00 € | ||
2500µg | 287.00 € |