CAS 134628-42-5

PIPERAZINE-2,2,3,3,5,5,6,6-D8

Description:

Piperazine-2,2,3,3,5,5,6,6-D8, with the CAS number 134628-42-5, is a deuterated form of piperazine, a cyclic organic compound featuring a six-membered ring containing two nitrogen atoms. The deuteration indicates that hydrogen atoms in the piperazine structure have been replaced with deuterium, a stable isotope of hydrogen, which enhances its utility in various scientific applications, particularly in NMR spectroscopy. This compound is characterized by its high solubility in polar solvents and is often used in research settings to study molecular interactions and dynamics due to its unique isotopic labeling. Piperazine derivatives are known for their biological activity, including applications in pharmaceuticals, but the specific biological properties of this deuterated variant may differ from its non-deuterated counterparts. Its stability, reactivity, and potential applications in drug development and analytical chemistry make it a valuable compound in both academic and industrial research.

Formula: C₄H₂D₈N₂

InChI: InChI=1S/C4H10N2/c1-2-6-4-3-5-1/h5-6H,1-4H2/i1D2,2D2,3D2,4D2

InChI key: GLUUGHFHXGJENI-SVYQBANQSA-N

SMILES: [2H]C1(C(NC(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])[2H]

Piperazine-D8

CAS: 134628-42-5

Piperazine-D8 is the deuterium labeled Piperazine (T73197). Piperazine (1,4-Diazacyclohexane), a gamma-aminobutyric acid (GABA) agonist, serves as a crucial building block and core component in a wide range of marketed drugs known for their varied pharmacological activities.

Formula: C₄H₁₀N₂

Molecular weight: 94.19

Ref: TM-TMIR-0073

Piperazine-2,2,3,3,5,5,6,6-d8

CAS: 110-85-0, 134628-42-5

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 94.19

Ref: 3U-D6283

Piperazine-2,2,3,3,5,5,6,6-d8

Controlled Product

CAS: 134628-42-5

Applications Piperazine-2,2,3,3,5,5,6,6-d8 (CAS# 134628-42-5) is a useful isotopically labeled research compound.

Formula: C₄D₈H₂N₂

Color and Shape: Neat

Molecular weight: 94.19

Ref: TR-P479902