CAS 134665-72-8: 2'-cyano-2'-deoxyarabinofuranosylcytosine
Description:2'-Cyano-2'-deoxyarabinofuranosylcytosine, also known as cytarabine or Ara-C, is a nucleoside analog with significant implications in medicinal chemistry, particularly in the treatment of certain types of cancer, such as leukemia. This compound features a cyano group at the 2' position of the deoxyribose sugar, which enhances its stability and bioactivity compared to other nucleosides. Its structure includes a cytosine base linked to a modified sugar moiety, which allows it to interfere with DNA synthesis and repair mechanisms in rapidly dividing cells. The presence of the cyano group contributes to its unique pharmacological properties, making it a potent inhibitor of DNA polymerase. As a result, 2'-cyano-2'-deoxyarabinofuranosylcytosine is utilized in chemotherapy regimens, although it may also exhibit cytotoxic effects on healthy cells, leading to various side effects. Understanding its characteristics is crucial for optimizing its therapeutic use and minimizing adverse reactions in clinical settings.
Formula:C10H13ClN4O4
InChI:InChI=1/C10H12N4O4.ClH/c11-3-5-8(16)6(4-15)18-9(5)14-2-1-7(12)13-10(14)17;/h1-2,5-6,8-9,15-16H,4H2,(H2,12,13,17);1H/t5-,6+,8-,9+;/m0./s1
- Synonyms:
- 2'-Cyano-2'deoxy-1-beta-D-arabinofuranosylcytosine
- 4-Amino-1-(2-cyano-2-deoxy-beta-D-arabinofuranosyl)-2(1H)-pyrimidinone monohydrochloride
- Cndac
- 2(1H)-Pyrimidinone, 4-amino-1-(2-cyano-2-deoxy-beta-D-arabinofuranosyl)-, monohydrochloride
- 4-amino-1-(2-cyano-2-deoxy-beta-D-arabinofuranosyl)pyrimidin-2(1H)-one hydrochloride
