CymitQuimica logo

CAS 1346808-65-8

:

3-fluoro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine,hydrochloride

Description:
3-Fluoro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole moieties. The presence of a fluorine atom at the 3-position contributes to its reactivity and potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. The dihydro form indicates that it has two hydrogen atoms added to the pyrrole ring, affecting its stability and reactivity. Its molecular structure suggests potential interactions with biological targets, making it of interest in pharmacological research. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions under which it is synthesized or stored. Overall, 3-fluoro-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine hydrochloride represents a significant compound for further exploration in the fields of organic and medicinal chemistry.
Formula:C7H8ClFN2
InChI:InChI=1S/C7H7FN2.ClH/c8-6-1-5-2-9-4-7(5)10-3-6;/h1,3,9H,2,4H2;1H
InChI key:VXFYNBRFDPWNKL-UHFFFAOYSA-N
SMILES:C1C2=C(CN1)N=CC(=C2)F.Cl
Found 3 products.