CAS 13482-22-9
:4-Hydroxycyclohexanone
Description:
4-Hydroxycyclohexanone, with the CAS number 13482-22-9, is an organic compound characterized by a cyclohexane ring with a hydroxyl group (-OH) and a ketone group (C=O) attached to it. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its ability to participate in various chemical reactions, including oxidation and reduction, due to the presence of both the hydroxyl and carbonyl functional groups. 4-Hydroxycyclohexanone is soluble in polar solvents like water and alcohols, which enhances its utility in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it exhibits properties that may influence its reactivity, such as the potential for intramolecular hydrogen bonding. Safety data indicates that, like many organic compounds, it should be handled with care to avoid inhalation or skin contact, and appropriate safety measures should be taken during its use in laboratory or industrial settings.
Formula:C6H10O2
InChI:InChI=1S/C6H10O2/c7-5-1-2-6(8)4-3-5/h5,7H,1-4H2
InChI key:InChIKey=BXBJZYXQHHPVGO-UHFFFAOYSA-N
SMILES:OC1CCC(=O)CC1
Synonyms:- Cyclohexanone, 4-hydroxy-
- 4-Hydroxycyclohexan-1-one
- 4-Hydroxycyclohexanone
- p-Hydroxycyclohexanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA003429
250gTo inquire500gTo inquire1g27.00€5g49.00€10g66.00€25g114.00€50g206.00€100g267.00€1kg1,926.00€4-Hydroxycyclohexan-1-one
CAS:4-Hydroxycyclohexan-1-oneFormula:C6H10O2Purity:99%Color and Shape: colorless to light yellow liquidMolecular weight:114.14g/mol4-Hydroxycyclohexanone
CAS:4-Hydroxycyclohexanone is a reactive compound that contains a hydroxy group and a hydroxyl group. It reacts with various substances, including hydrogen bond, to form new compounds. 4-Hydroxycyclohexanone is used in the industrial production of other chemicals, such as cyclohexanone. The reactivity of 4-hydroxycyclohexanone can be determined by its nmr spectra. The deshielding effect of the hydroxyl group causes an upfield shift in the nmr spectrum. In addition, 4-hydroxycyclohexanone reacts with hydrochloric acid to form an ester and water. The reaction mechanism for this process is nucleophilic attack by the hydroxyl group on the carbonyl carbon atom in hydroxycyclohexanone.Formula:C6H10O2Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:114.15 g/molRef: 10-F069093
250mg9.00€1g12.00€5g29.00€10g57.00€25g123.00€50g228.00€100g377.00€250g807.00€500g1,505.00€




