CymitQuimica logo

CAS 1349807-59-5

:

2-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2)

Description:
2-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine and pyrrolidine moieties, which contribute to its biological activity. The presence of the pyrimidinamine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability. The compound's stereochemistry, indicated by the (3R) configuration, may influence its interaction with biological targets, potentially affecting its efficacy and safety profile. This compound may exhibit properties such as being a weak base due to the amine group, and its hydrochloride form can stabilize the molecule, making it suitable for formulation in drug development. Overall, its unique structural features and solubility characteristics make it a candidate for further investigation in therapeutic applications, particularly in areas related to neuropharmacology or oncology, although specific biological activities would require empirical studies for validation.
Formula:C8H12N4·2ClH
InChI:InChI=1S/C8H12N4.2ClH/c1-3-10-8(11-4-1)12-7-2-5-9-6-7;;/h1,3-4,7,9H,2,5-6H2,(H,10,11,12);2*1H/t7-;;/m1../s1
InChI key:InChIKey=DZLSFIBJSUBJHM-XCUBXKJBSA-N
SMILES:N(C=1N=CC=CN1)[C@@H]2CCNC2.Cl
Synonyms:
  • 2-Pyrimidinamine, N-(3R)-3-pyrrolidinyl-, hydrochloride (1:2)
Found 3 products.