CymitQuimica logo

CAS 134997-74-3

:

2H-1,4-Benzoxazine-6-carbonitrile, 3,4-dihydro-3-oxo-

Description:
2H-1,4-Benzoxazine-6-carbonitrile, 3,4-dihydro-3-oxo- is a heterocyclic organic compound characterized by its benzoxazine structure, which includes a fused benzene and oxazine ring. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in various chemical processes. The presence of a keto group enhances its electrophilic character, making it useful in synthetic organic chemistry. Typically, compounds of this class exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. They may also demonstrate biological activity, which can be explored for pharmaceutical applications. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the compound's purity and the conditions under which it is analyzed. Overall, 2H-1,4-Benzoxazine-6-carbonitrile, 3,4-dihydro-3-oxo- represents a versatile structure with potential utility in both academic research and industrial applications.
Formula:C9H6N2O2
InChI:InChI=1S/C9H6N2O2/c10-4-6-1-2-8-7(3-6)11-9(12)5-13-8/h1-3H,5H2,(H,11,12)
InChI key:WCBILQWUWLALFZ-UHFFFAOYSA-N
SMILES:C1C(=O)NC2=C(O1)C=CC(=C2)C#N
Found 4 products.