CAS 135-00-2
:2-Benzoylthiophene
Description:
2-Benzoylthiophene is an organic compound characterized by its unique structure, which consists of a thiophene ring substituted with a benzoyl group at the second position. This compound typically appears as a yellow to light brown solid and is known for its aromatic properties due to the presence of both the benzene and thiophene rings. It has a relatively high melting point and is soluble in organic solvents such as ethanol and acetone, but less soluble in water. 2-Benzoylthiophene exhibits interesting photochemical properties, making it useful in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals and agrochemicals. Additionally, it can participate in various chemical reactions, such as Friedel-Crafts acylation and photochemical reactions, due to the reactivity of the carbonyl group. Its unique electronic structure also allows it to act as a potential ligand in coordination chemistry. Overall, 2-benzoylthiophene is a versatile compound with significant relevance in both academic research and industrial applications.
Formula:C11H8OS
InChI:InChI=1S/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H
InChI key:InChIKey=DWYFUJJWTRPARQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=CS1)C2=CC=CC=C2
Synonyms:- 2-Benzoylthiophene, (Phenyl 2-thienyl ketone)
- 2-Thienyl phenyl ketone
- Ketone, phenyl 2-thienyl
- Methanone, phenyl-2-thienyl-
- NSC 4502
- Phenyl 2-thienyl ketone
- Phenyl thiophene-2-yl ketone
- Phenyl(2-thienyl)methanone
- Phenyl(Thiophen-2-Yl)Methanone
- Phenyl-2-thienylmethanone
- α-Benzoylthiophene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Benzoylthiophene
CAS:Formula:C11H8OSPurity:>98.0%(GC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:188.242-Benzoylthiophene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H8OSPurity:98%Color and Shape:Pale cream to cream, Crystals or powder or crystalline powder or lumps or fused solidMolecular weight:188.24Phenyl(thiophen-2-yl)methanone
CAS:Formula:C11H8OSPurity:98%Color and Shape:SolidMolecular weight:188.24562-Benzoylthiophene
CAS:2-Benzoylthiophene is an aromatic hydrocarbon that is used to synthesize other compounds. It has antihistaminic activity, which may be due to its ability to inhibit histamine release from mast cells and basophils. 2-Benzoylthiophene also has conformational properties that allow it to function as a homodimer in kinetic studies, which can be used to study the mechanism of enzyme catalysis. 2-Benzoylthiophene can undergo chloride transfer reactions with diethyl succinate, leading to a molecule with a positive charge on C2. This reaction is catalyzed by protonation of the C2 carbon atom.Formula:C11H8OSPurity:Min. 95%Color and Shape:PowderMolecular weight:188.25 g/mol





