
CAS 1350547-65-7
:UNC569
Description:
UNC569, with the CAS number 1350547-65-7, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule inhibitor, specifically targeting the protein kinase CK2, which plays a crucial role in various cellular processes, including cell proliferation and survival. The inhibition of CK2 has been linked to anti-cancer effects, making UNC569 a candidate for further research in oncology. The compound is characterized by its unique molecular structure, which contributes to its specificity and potency against CK2. Additionally, UNC569 has been studied for its effects on various signaling pathways, indicating its potential utility in modulating cellular responses. As with many investigational compounds, its safety profile, pharmacokinetics, and efficacy in clinical settings are subjects of ongoing research. Overall, UNC569 represents a promising avenue for drug development aimed at targeting specific molecular pathways in disease treatment.
Formula:C22H29FN6
InChI:InChI=1S/C22H29FN6/c1-2-3-12-25-22-26-13-19-20(16-6-8-17(23)9-7-16)28-29(21(19)27-22)14-15-4-10-18(24)11-5-15/h6-9,13,15,18H,2-5,10-12,14,24H2,1H3,(H,25,26,27)
InChI key:OGEBRHQLRGFBNV-UHFFFAOYSA-N
SMILES:CCCCNC1=NC=C2C(=NN(C2=N1)CC3CCC(CC3)N)C4=CC=C(C=C4)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
UNC569
CAS:1-((trans-4-Aminocyclohexyl)methyl)-N-butyl-3-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-6-amineFormula:C22H29FN6Purity:99%Molecular weight:396.5UNC569
CAS:UNC569 selectively inhibits kidney URAT1, regulating uric acid excretion and aiding gout patient's uric balance.Formula:C22H29FN6Purity:98.91% - 99.67%Color and Shape:SolidMolecular weight:396.5UNC 569
CAS:UNC 569 is a potential anti-platelet agent that has been shown to inhibit the proliferation of human microglia cells. It binds to an inhibitory death receptor protein, DR5, and blocks the signaling pathway for apoptosis. UNC 569 also inhibits the production of platelets by binding to the alpha-granules in megakaryocytes. The efficacy of UNC 569 as an anti-infective agent is not yet known. UNC 569 is a molecule with a molecular weight of approximately 3,000 daltons and has been shown to bind to proteins that regulate cell division. This inhibitor binds to proteins that are involved in the regulation of cell division, such as growth factors, protein targets, and anti-platelet agents. It has also been shown to have selective toxicity profiles for murine xenografts and cell nuclei.Formula:C22H29FN6Purity:Min. 95%Molecular weight:396.5 g/mol





