CAS 135192-53-9
:pentafluorophenyl chlorothionoformate
Description:
Pentafluorophenyl chlorothionoformate is a chemical compound characterized by its unique structure, which includes a pentafluorophenyl group and a chlorothionoformate moiety. This compound is typically used in organic synthesis, particularly in the preparation of various derivatives and as a reagent in chemical reactions. The presence of the pentafluorophenyl group imparts significant electron-withdrawing properties, enhancing the reactivity of the compound. It is known for its stability under standard conditions, but it can be sensitive to moisture and should be handled in a dry environment. The chlorothionoformate functional group contributes to its ability to act as an acylating agent, making it useful in the synthesis of thioesters and other sulfur-containing compounds. Safety precautions are essential when handling this substance, as it may be harmful if inhaled or ingested, and it can cause skin and eye irritation. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its integrity and reactivity.
Formula:C7ClF5OS
InChI:InChI=1/C7ClF5OS/c8-7(15)14-6-4(12)2(10)1(9)3(11)5(6)13
SMILES:c1(c(c(c(c(c1F)F)OC(=S)Cl)F)F)F
Synonyms:- O-(pentafluorophenyl) chlorothiocarbonate
- Pentafluorophenyl Chlorothioformate
- O-(perfluorophenyl) chlorothioformate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pentafluorophenyl Chlorothionoformate
CAS:Formula:C7ClF5OSPurity:>95.0%(GC)Color and Shape:Light yellow to Amber to Dark green clear liquidMolecular weight:262.58Pentafluorophenyl Chlorothionoformate
CAS:Pentafluorophenyl ChlorothionoformateFormula:C7ClF5OSPurity:95%Molecular weight:262.58Pentafluorophenyl chlorothionoformate
CAS:Pentafluorophenyl chlorothionoformate is a model system that can be used to study the interactions between functional groups and chemokine receptors. It has been shown to inhibit the activity of hydroxy group containing enzymes such as tyrosinase, which is involved in the production of melanin. The acidic functional group was shown to have receptor activity with chemokine receptors, like CCR2 and CXCR4, while the hydroxyl group was shown to interact with carbonyl groups containing enzymes such as taxol. Pentafluorophenyl chlorothionoformate also has monomeric properties.Formula:C7ClF5OSPurity:Min. 95%Color and Shape:Clear Light (Or Pale) Yellow To Dark Yellow To Reddish Brown LiquidMolecular weight:262.59 g/molPentafluorophenyl Chlorothionoformate
CAS:Controlled ProductFormula:C7ClF5OSColor and Shape:NeatMolecular weight:262.59




